Molecule:100877: Difference between revisions
From ChemWiki
![](/main/mediawiki/extensions/ChemExtension/skins/images/molecule.png)
(auto-generated) |
(auto-generated) |
||
(2 intermediate revisions by the same user not shown) | |||
Line 2: | Line 2: | ||
|trivialname= | |trivialname= | ||
|abbrev= | |abbrev= | ||
|molecularFormula=C<sub>132</sub>H<sub>108</sub> | |molecularFormula=C<sub>132</sub>H<sub>108</sub>F<sub>18</sub>N<sub>6</sub>O<sub>6</sub>P<sub>9</sub>Re<sub>3</sub> | ||
|molecularMass= | |molecularMass=3054.435407106 | ||
|synonyms= | |synonyms= | ||
|hasVendors= | |hasVendors= | ||
|moleculeKey= | |moleculeKey=JLRZSCLFGATQEH-UHFFFAOYSA-T | ||
|molOrRxn= | |molOrRxn= | ||
RDKit 2D | RDKit 2D | ||
Line 12: | Line 12: | ||
0 0 0 0 0 0 0 0 0 0999 V3000 | 0 0 0 0 0 0 0 0 0 0999 V3000 | ||
M V30 BEGIN CTAB | M V30 BEGIN CTAB | ||
M V30 COUNTS | M V30 COUNTS 174 195 0 0 0 | ||
M V30 BEGIN ATOM | M V30 BEGIN ATOM | ||
M V30 1 C 6.35983 -3.83559 0 0 | M V30 1 C 6.35983 -3.83559 0 0 | ||
Line 161: | Line 161: | ||
M V30 146 N 3.49324 -8.62354 0 0 | M V30 146 N 3.49324 -8.62354 0 0 | ||
M V30 147 C 3.04337 -7.85585 0 0 | M V30 147 C 3.04337 -7.85585 0 0 | ||
M V30 148 C 4.82786 -12.4793 0 0 | M V30 148 P 16.625 -2.225 0 0 CHG=-1 | ||
M V30 | M V30 149 F 16.125 -1.35897 0 0 | ||
M V30 | M V30 150 F 16.125 -3.09103 0 0 | ||
M V30 | M V30 151 F 17.625 -2.225 0 0 | ||
M V30 | M V30 152 F 17.125 -1.35897 0 0 | ||
M V30 | M V30 153 F 17.125 -3.09103 0 0 | ||
M V30 154 F 15.625 -2.225 0 0 | |||
M V30 155 P 2.775 -2.375 0 0 CHG=-1 | |||
M V30 156 F 2.275 -1.50897 0 0 | |||
M V30 157 F 2.275 -3.24103 0 0 | |||
M V30 158 F 3.775 -2.375 0 0 | |||
M V30 159 F 3.275 -1.50897 0 0 | |||
M V30 160 F 3.275 -3.24103 0 0 | |||
M V30 161 F 1.775 -2.375 0 0 | |||
M V30 162 P 9.55 -13.35 0 0 CHG=-1 | |||
M V30 163 F 9.05 -12.484 0 0 | |||
M V30 164 F 9.05 -14.216 0 0 | |||
M V30 165 F 10.55 -13.35 0 0 | |||
M V30 166 F 10.05 -12.484 0 0 | |||
M V30 167 F 10.05 -14.216 0 0 | |||
M V30 168 F 8.55 -13.35 0 0 | |||
M V30 169 C 4.82786 -12.4793 0 0 | |||
M V30 170 C 1.71137 -7.08835 0 0 | |||
M V30 171 C 14.1785 -12.4648 0 0 | |||
M V30 172 C 17.2895 -7.07069 0 0 | |||
M V30 173 C 6.3044 0.786395 0 0 | |||
M V30 174 C 12.5314 0.789322 0 0 | |||
M V30 END ATOM | M V30 END ATOM | ||
M V30 BEGIN BOND | M V30 BEGIN BOND | ||
Line 340: | Line 361: | ||
M V30 170 10 27 128 | M V30 170 10 27 128 | ||
M V30 171 10 27 134 | M V30 171 10 27 134 | ||
M V30 172 1 | M V30 172 1 148 149 | ||
M V30 173 1 145 | M V30 173 1 148 150 | ||
M V30 | M V30 174 1 148 151 | ||
M V30 | M V30 175 1 148 152 | ||
M V30 | M V30 176 1 148 153 | ||
M V30 | M V30 177 1 148 154 | ||
M V30 178 1 155 156 | |||
M V30 179 1 155 157 | |||
M V30 180 1 155 158 | |||
M V30 181 1 155 159 | |||
M V30 182 1 155 160 | |||
M V30 183 1 155 161 | |||
M V30 184 1 162 163 | |||
M V30 185 1 162 164 | |||
M V30 186 1 162 165 | |||
M V30 187 1 162 166 | |||
M V30 188 1 162 167 | |||
M V30 189 1 162 168 | |||
M V30 190 1 138 169 | |||
M V30 191 1 145 170 | |||
M V30 192 1 121 171 | |||
M V30 193 1 114 172 | |||
M V30 194 1 126 173 | |||
M V30 195 1 133 174 | |||
M V30 END BOND | M V30 END BOND | ||
M V30 END CTAB | M V30 END CTAB | ||
M END | M END | ||
|smiles=Cc1ccc2n(~[Re+]3(~[C-]#[O+])(~[C-]#[O+])(~P(c4ccccc4)(c4ccccc4)c4ccc(cc4)P(c4ccccc4)(c4ccccc4)~[Re+]4(~[C-]#[O+])(~[C-]#[O+])(~P(c5ccccc5)(c5ccccc5)c5ccc(cc5)P(c5ccccc5)(c5ccccc5)~[Re+]5(~[C-]#[O+])(~[C-]#[O+])(~P(c6ccccc6)(c6ccccc6)c6ccc(cc6)P~3(c3ccccc3)c3ccccc3)~n3cc(C)ccc3-c3ccc(C)cn~53)~n3cc(C)ccc3-c3ccc(C)cn~43)~n3cc(C)ccc3-2)c1 | |smiles=Cc1ccc2n(~[Re+]3(~[C-]#[O+])(~[C-]#[O+])(~P(c4ccccc4)(c4ccccc4)c4ccc(cc4)P(c4ccccc4)(c4ccccc4)~[Re+]4(~[C-]#[O+])(~[C-]#[O+])(~P(c5ccccc5)(c5ccccc5)c5ccc(cc5)P(c5ccccc5)(c5ccccc5)~[Re+]5(~[C-]#[O+])(~[C-]#[O+])(~P(c6ccccc6)(c6ccccc6)c6ccc(cc6)P~3(c3ccccc3)c3ccccc3)~n3cc(C)ccc3-c3ccc(C)cn~53)~n3cc(C)ccc3-c3ccc(C)cn~43)~n3cc(C)ccc3-2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F | ||
|inchi=InChI=1S/3C30H24P2.3C12H12N2.6CO.3Re/c3*1-5-13-25(14-6-1)31(26-15-7-2-8-16-26)29-21-23-30(24-22-29)32(27-17-9-3-10-18-27)28-19-11-4-12-20-28;3*1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12;6*1-2;;;/h3*1-24H;3*3-8H,1-2H3;;;;;;;;;/q;;;;;;;;;;;; | |inchi=InChI=1S/3C30H24P2.3C12H12N2.6CO.3F6P.3Re/c3*1-5-13-25(14-6-1)31(26-15-7-2-8-16-26)29-21-23-30(24-22-29)32(27-17-9-3-10-18-27)28-19-11-4-12-20-28;3*1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12;6*1-2;3*1-7(2,3,4,5)6;;;/h3*1-24H;3*3-8H,1-2H3;;;;;;;;;;;;/q;;;;;;;;;;;;6*-1/p+6 | ||
|inchikey= | |inchikey=JLRZSCLFGATQEH-UHFFFAOYSA-T | ||
|width=200 | |width=200 | ||
|height=200 | |height=200 |
Latest revision as of 13:46, 3 May 2024
Properties | |
---|---|
CID | n/a |
CAS | n/a |
IUPAC-Name | n/a |
Abbreviation | n/a |
Trivialname | n/a |
Exact mass | 3054.435407106 |
Molecular formula | C132H108F18N6O6P9Re3 |
LogP | n/a |
Has vendors | n/a |
Molecular role | n/a |
Synonyms | n/a |
Click here to copy MOL-file.
Click here to show SMILES and InChI.
Belongs to molecule collection: Molecule collection 100730
The molecule template was defined here: Rhenium(I) trinuclear rings as highly efficient redox photosensitizers for photocatalytic CO2 reduction
Molecule is used on following pages
topic
- Photocatalytic CO2 conversion to CO
- Homogeneous photocatalytic CO2 conversion
- Photocatalytic CO2 conversion to HCOOH
publication
investigation
- Rhenium(I) trinuclear rings as highly efficient redox photosensitizers for photocatalytic CO2 reduction/Table 1
- Rhenium(I) trinuclear rings as highly efficient redox photosensitizers for photocatalytic CO2 reduction/Table 2
Molecule roles
Investigation type | Photosensitizer |
---|---|
Photocatalytic CO2 conversion experiments |
![]() |
Cyclic Voltammetry experiments | ![]() |
Absorption Emission Spectroscopy experiments | ![]() |