Molecule:100931: Difference between revisions
From ChemWiki
molecule
Replaced content with "{{Molecule |trivialname=1-amino-4-hydroxyanthraquinone }}" Tag: Replaced |
auto-generated |
||
| Line 1: | Line 1: | ||
{{Molecule | {{Molecule | ||
|trivialname=1-amino-4-hydroxyanthraquinone | |trivialname=1-amino-4-hydroxyanthraquinone | ||
|molOrRxn= | |||
RDKit 2D | |||
0 0 0 0 0 0 0 0 0 0999 V3000 | |||
M V30 BEGIN CTAB | |||
M V30 COUNTS 18 20 0 0 0 | |||
M V30 BEGIN ATOM | |||
M V30 1 C 4.13485 -3.75007 0 0 | |||
M V30 2 C 5.86515 -3.74959 0 0 | |||
M V30 3 C 5.00164 -3.24997 0 0 | |||
M V30 4 C 5.86515 -4.75053 0 0 | |||
M V30 5 C 4.13485 -4.75502 0 0 | |||
M V30 6 C 5.00382 -5.25003 0 0 | |||
M V30 7 C 6.73201 -5.25103 0 0 | |||
M V30 8 C 7.59886 -4.75058 0 0 | |||
M V30 9 C 7.59886 -3.74963 0 0 | |||
M V30 10 C 6.73201 -3.24914 0 0 | |||
M V30 11 O 6.73202 -2.24914 0 0 | |||
M V30 12 O 6.73201 -6.25103 0 0 | |||
M V30 13 C 8.46336 -3.25126 0 0 | |||
M V30 14 C 9.33054 -3.75159 0 0 | |||
M V30 15 C 8.46951 -5.25291 0 0 | |||
M V30 16 C 9.33274 -4.7475 0 0 | |||
M V30 17 N 8.46353 -2.25126 0 0 | |||
M V30 18 O 8.4727 -6.25291 0 0 | |||
M V30 END ATOM | |||
M V30 BEGIN BOND | |||
M V30 1 4 3 1 | |||
M V30 2 4 4 2 | |||
M V30 3 4 1 5 | |||
M V30 4 4 2 3 | |||
M V30 5 4 5 6 | |||
M V30 6 4 6 4 | |||
M V30 7 1 4 7 | |||
M V30 8 1 7 8 | |||
M V30 9 4 8 9 | |||
M V30 10 1 9 10 | |||
M V30 11 1 10 2 | |||
M V30 12 2 10 11 | |||
M V30 13 2 7 12 | |||
M V30 14 4 14 13 | |||
M V30 15 4 8 15 | |||
M V30 16 4 13 9 | |||
M V30 17 4 15 16 | |||
M V30 18 4 16 14 | |||
M V30 19 1 13 17 | |||
M V30 20 1 15 18 | |||
M V30 END BOND | |||
M V30 END CTAB | |||
M END | |||
|moleculeKey=AQXYVFBSOOBBQV-UHFFFAOYSA-N | |||
|smiles=Nc1ccc(O)c2c1C(=O)c1ccccc1C2=O | |||
|inchi=InChI=1S/C14H9NO3/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,16H,15H2 | |||
|inchikey=AQXYVFBSOOBBQV-UHFFFAOYSA-N | |||
}} | }} | ||
Latest revision as of 16:18, 10 March 2025
| Properties | |
|---|---|
| CID | n/a |
| CAS | n/a |
| IUPAC-Name | n/a |
| Abbreviation | n/a |
| Trivialname | 1-amino-4-hydroxyanthraquinone |
| Exact mass | n/a |
| Molecular formula | n/a |
| LogP | n/a |
| Has vendors | n/a |
| Molecular role | n/a |
| Synonyms | n/a |
1-amino-4-hydroxyanthraquinone
Click here to copy MOL-file.
Click here to show SMILES and InChI.
Property "BelongsToCollection" (as page type) with input value "{{{parent}}}" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
Molecule is used on following pages
publication
investigation


