Highly Efficient and Selective Photocatalytic CO2 Reduction by Iron and Cobalt Quaterpyridine Complexes: Difference between revisions
publication
| About |
|---|
m auto-updated |
m auto-generated |
||
| (7 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
{{ | {{DOI|doi=10.1021/jacs.6b06002}} | ||
[[Category:Photocatalytic CO2 conversion to CO]] | [[Category:Photocatalytic CO2 conversion to CO]] | ||
{{BaseTemplate}} | {{BaseTemplate}} | ||
| Line 7: | Line 7: | ||
A photochemical reduction of CO<sub>2</sub> to CO was shown using the cobalt complex {{#moleculelink:|link=NLKWUAXOGCKGEY-UHFFFAOYSA-L|image=false|width=300|height=200}} or the iron complex {{#moleculelink:|link=OZQYFMFOIFRRLI-UHFFFAOYSA-L|image=false|width=300|height=200}} as catalysts in combination with the ruthenium-based photosensitizer {{#moleculelink:|link=SJFYGUKHUNLZTK-UHFFFAOYSA-L|image=false|width=300|height=200}}. Turnover numbers (TONs) up to 2660 and a selectivity of 98% for CO using the cobalt catalyst and TONs of >3000 and a selectivity of 95% for CO using the iron catalyst were reached in acetonitrile/triethanolamine. When swapping the ruthenium photosensitizer for the organic dye sensitizer {{#moleculelink:|link=BBNQQADTFFCFGB-UHFFFAOYSA-N|image=false|width=300|height=200}}, TONs of 790 and 1365 in DMF were obtained for the cobalt and iron catalysts, respectively. The experiments were conducted under visible-light irradiation (λ = 460 nm) using BIH as sacrificial reductant (see section SEDs below). | A photochemical reduction of CO<sub>2</sub> to CO was shown using the cobalt complex {{#moleculelink:|link=NLKWUAXOGCKGEY-UHFFFAOYSA-L|image=false|width=300|height=200}} or the iron complex {{#moleculelink:|link=OZQYFMFOIFRRLI-UHFFFAOYSA-L|image=false|width=300|height=200}} as catalysts in combination with the ruthenium-based photosensitizer {{#moleculelink:|link=SJFYGUKHUNLZTK-UHFFFAOYSA-L|image=false|width=300|height=200}}. Turnover numbers (TONs) up to 2660 and a selectivity of 98% for CO using the cobalt catalyst and TONs of >3000 and a selectivity of 95% for CO using the iron catalyst were reached in acetonitrile/triethanolamine. When swapping the ruthenium photosensitizer for the organic dye sensitizer {{#moleculelink:|link=BBNQQADTFFCFGB-UHFFFAOYSA-N|image=false|width=300|height=200}}, TONs of 790 and 1365 in DMF were obtained for the cobalt and iron catalysts, respectively. The experiments were conducted under visible-light irradiation (λ = 460 nm) using BIH as sacrificial reductant (see section SEDs below). | ||
==== Advances and special progress==== | ==== Advances and special progress==== | ||
The photocatalytic reduction of CO<sub>2</sub> to CO by cobalt and iron complexes was shown with some of the highest TONs for homogeneous photocatalytic | The photocatalytic reduction of CO<sub>2</sub> to CO by cobalt and iron complexes was shown with some of the highest TONs for homogeneous photocatalytic CO<sub>2</sub> reduction at that time and the (back then) highest TON for a system of fully earth-abundant materials was achieved. | ||
====Additional remarks==== | ====Additional remarks==== | ||
===Content of the published article in detail=== | ===Content of the published article in detail=== | ||
The article contains results for the reduction of CO<sub>2</sub> to CO under visible-light catalysis using cobalt and iron quaterpyridine complexes as catalysts. The catalytic system performs best (referring to the TON of CO production) in acetonitrile/triethanolamine using the cobalt complex and the ruthenium photosensitizer. | The article contains results for the reduction of CO<sub>2</sub> to CO under visible-light catalysis using cobalt and iron quaterpyridine complexes as catalysts. The catalytic system performs best (referring to the TON of CO production) in acetonitrile/triethanolamine using the cobalt complex {{#moleculelink:|link=OZQYFMFOIFRRLI-UHFFFAOYSA-L|image=false|width=300|height=200}} and the ruthenium photosensitizer. | ||
==== Catalysts ==== | ==== Catalysts ==== | ||
<chemform smiles="C1C2C3C=CC=C4C5C=CC=C6C7C=CC=CN=7[Fe+2](O)(O)(N=34)(N=56)N=2C=CC=1.Cl([O-])(=O)(=O)=O.Cl([O-])(=O)(=O)=O" inchi="1S/C20H14N4.2ClHO4.Fe.2H2O/c1-3-13-21-15(7-1)17-9-5-11-19(23-17)20-12-6-10-18(24-20)16-8-2-4-14-22-16;2*2-1(3,4)5;;;/h1-14H;2*(H,2,3,4,5);;2*1H2/q;;;+2;;/p-2" inchikey="NLKWUAXOGCKGEY-UHFFFAOYSA-L" height="200px" width="300px" float="none"> | <chemform smiles="C1C2C3C=CC=C4C5C=CC=C6C7C=CC=CN=7[Fe+2](O)(O)(N=34)(N=56)N=2C=CC=1.Cl([O-])(=O)(=O)=O.Cl([O-])(=O)(=O)=O" inchi="1S/C20H14N4.2ClHO4.Fe.2H2O/c1-3-13-21-15(7-1)17-9-5-11-19(23-17)20-12-6-10-18(24-20)16-8-2-4-14-22-16;2*2-1(3,4)5;;;/h1-14H;2*(H,2,3,4,5);;2*1H2/q;;;+2;;/p-2" inchikey="NLKWUAXOGCKGEY-UHFFFAOYSA-L" height="200px" width="300px" float="none"> | ||
| Line 381: | Line 381: | ||
{{#experimentlist: |form=Photocatalytic_CO2_conversion_experiments|name=Optimizations of conditions for Co(qpy)(H2O)2(ClO4)2 and Ru(bpy)3Cl2}} | {{#experimentlist: |form=Photocatalytic_CO2_conversion_experiments|name=Optimizations of conditions for Co(qpy)(H2O)2(ClO4)2 and Ru(bpy)3Cl2}} | ||
{{#experimentlist:|form=Photocatalytic_CO2_conversion_experiments|name=Fe(qpy)(H2O)2(ClO4)2 and Ru(bpy)3Cl2}} | {{#experimentlist: |form=Photocatalytic_CO2_conversion_experiments|name=Optimizations of conditions for Fe(qpy)(H2O)2(ClO4)2 and Ru(bpy)3Cl2}} | ||
{{#experimentlist:|form=Photocatalytic_CO2_conversion_experiments|name=Co(qpy)(H2O)2(ClO4)2 and purpurin}} | {{#experimentlist: |form=Photocatalytic_CO2_conversion_experiments|name=Optimizations of conditions for Co(qpy)(H2O)2(ClO4)2 and purpurin}} | ||
{{#experimentlist:|form=Photocatalytic_CO2_conversion_experiments|name=Fe(qpy)(H2O)2(ClO4)2}} | {{#experimentlist: |form=Photocatalytic_CO2_conversion_experiments|name=Optimizations of conditions for Fe(qpy)(H2O)2(ClO4)2}} | ||
==== Sacrificial electron donor ==== | ==== Sacrificial electron donor ==== | ||
In this study, the experiments were done with the sacrificial reductant BIH ([[Molecule:100508|100508]]). | In this study, the experiments were done with the sacrificial reductant BIH ([[Molecule:100508|100508]]). | ||
==== Additives==== | ==== Additives==== | ||
In this study, control experiments were conducted under an argon atmosphere. | In this study, control experiments were conducted under an argon atmosphere.[[Category:Publication]] | ||
{{Tags|tags=photochemistry, photocatalysis, CO2 reduction, homogeneous catalysis, cobalt catalyst, iron catalyst, quaterpyridine complexes, Ru(bpy)3, ruthenium photosensitizer, purpurin, organic dye sensitizer, BIH, sacrificial electron donor, visible-light irradiation, CO evolution, turnover number, selectivity, acetonitrile, triethanolamine, DMF, earth-abundant metals}} | |||
Latest revision as of 12:41, 21 November 2025
Abstract[edit | edit source]
Summary[edit | edit source]
A photochemical reduction of CO2 to CO was shown using the cobalt complex [Fe(qpy)(H2O)2][ClO4]2 or the iron complex [Co(qpy)(H2O)2][ClO4]2 as catalysts in combination with the ruthenium-based photosensitizer Ru(bpy)3Cl2. Turnover numbers (TONs) up to 2660 and a selectivity of 98% for CO using the cobalt catalyst and TONs of >3000 and a selectivity of 95% for CO using the iron catalyst were reached in acetonitrile/triethanolamine. When swapping the ruthenium photosensitizer for the organic dye sensitizer purpurin, TONs of 790 and 1365 in DMF were obtained for the cobalt and iron catalysts, respectively. The experiments were conducted under visible-light irradiation (λ = 460 nm) using BIH as sacrificial reductant (see section SEDs below).
Advances and special progress[edit | edit source]
The photocatalytic reduction of CO2 to CO by cobalt and iron complexes was shown with some of the highest TONs for homogeneous photocatalytic CO2 reduction at that time and the (back then) highest TON for a system of fully earth-abundant materials was achieved.
Additional remarks[edit | edit source]
Content of the published article in detail[edit | edit source]
The article contains results for the reduction of CO2 to CO under visible-light catalysis using cobalt and iron quaterpyridine complexes as catalysts. The catalytic system performs best (referring to the TON of CO production) in acetonitrile/triethanolamine using the cobalt complex [Co(qpy)(H2O)2][ClO4]2 and the ruthenium photosensitizer.
Catalysts[edit | edit source]
[Fe(qpy)(H2O)2][ClO4]2
[Co(qpy)(H2O)2][ClO4]2
Co(ClO4)2
Photosensitizers[edit | edit source]
Investigations[edit | edit source]
| cat | cat conc [µM] | PS | PS conc [mM] | e-D | e-D conc [M] | . | . | solvent A | additives | λexc [nm] | . | TON CO | TON H2 | TON HCOOH | . | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1. | 5 | 0.3 | 0.1 | 460 (LED) | 2660 | 23 | 35 | |||||||||
| 2. | 0 | 0.3 | 0.1 | 460 (LED) | 0 | 2 | 1 | |||||||||
| 3. | 5 | 0.3 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 33 | 0 | ||||||||
| 4. | 5 | 0.3 | 0.1 | 460 (LED) | 182 | 0 | 11 | |||||||||
| 5. | 5 | 0.3 | 460 (LED) | 114 | 25 | 25 | ||||||||||
| 6. | 10 | 0.3 | 0.1 | 460 (LED) | 1875 | 11 | 18 | |||||||||
| 7. | 200 | 0.3 | 0.1 | 460 (LED) | 1262 | 7 | 23 | |||||||||
| 8. | 50 | 0.3 | 0.1 | 460 (LED) | 497 | 5 | 3 | |||||||||
| 9. | 50 | 0.3 | 460 (LED) | 0 | 1 | 1 | ||||||||||
| 10. | 100 | 0.3 | 0.1 | 460 (LED) | 466 | 2 | 22 | |||||||||
| 11. | 50 | 0.5 | 0.1 | 460 (LED) | 521 | 49 | 6 | |||||||||
| 12. | 0 | 0.5 | 0.1 | 460 (LED) | 136 | 43 | 5 | |||||||||
| 13. | 50 | 0.2 | 0.1 | 460 (LED) | 366 | 15 | 4 | |||||||||
| 14. | 50 | 0.2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 3 | 1 | ||||||||
| 15. | 0 | 0.2 | 0.1 | 460 (LED) | 0 | 6 | 1 | |||||||||
| 16. | 50 | 0.3 | 0.1 | 460 (LED) | 33 | 11 | 1 | |||||||||
| 17. | 50 | 0.3 | 460 (LED) | 0 | 1 | 1 |

| cat | cat conc [µM] | PS | PS conc [mM] | e-D | e-D conc [M] | solvent A | . | . | additives | λexc [nm] | . | TON CO | TON H2 | TON HCOOH | . | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1. | 50 | 0.2 | 0.1 | 460 (LED) | 1879 | 15 | 48 | |||||||||
| 2. | 50 | 0.2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 1 | 3 | ||||||||
| 3. | 0 | 0.2 | 0.1 | 460 (LED) | 0 | 0 | 0 | |||||||||
| 4. | 20 | 0.2 | 0.1 | 460 (LED) | 2660 | 29 | 51 | |||||||||
| 5. | 20 | 0.2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 0 | 0 | ||||||||
| 6. | 10 | 0.2 | 0.1 | 460 (LED) | 3087 | 121 | 35 | |||||||||
| 7. | 10 | 0.2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 0 | 0 | ||||||||
| 8. | 5 | 0.2 | 0.1 | 460 (LED) | 3844 | 118 | 534 | |||||||||
| 9. | 5 | 0.2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 1 | 0 | ||||||||
| 10. | 50 | 0.05 | 0.1 | 460 (LED) | 1336 | 10 | 34 | |||||||||
| 11. | 50 | 0.05 | 0.1 | 460 (LED) | 0 | 0 | 0 | |||||||||
| 12. | 0 | 0.05 | 0.1 | 460 (LED) | 0 | 1 | 0 | |||||||||
| 13. | 5 | 0.2 | 460 (LED) | 160 | 8 | 22 |

| cat | cat conc [µM] | PS | PS conc [mM] | e-D | e-D conc [M] | solvent A | additives | λexc [nm] | . | TON CO | TON H2 | TON HCOOH | . | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1. | 50 | 2 | 0.1 | 460 (LED) | 197 | 1 | 9 | |||||||
| 2. | 50 | 2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 78 | 6 | ||||||
| 3. | 0 | 2 | 0.1 | 460 (LED) | 0 | 0 | 90 | |||||||
| 4. | 50 | 0 | 0.1 | 460 (LED) | 27 | 0 | 4 | |||||||
| 5. | 50 | 2 | 460 (LED) | 0 | 0 | 3 | ||||||||
| 6. | 5 | 2 | 0.1 | 460 (LED) | 790 | 11 | 78 | |||||||
| 7. | 5 | 2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 226 | 167 | ||||||
| 8. | 5 | 2 | Argon atmosphere | 460 (LED) | 0 | 0 | 26 | |||||||
| 9. | 50 | 2 | 0.1 | 460 (LED) | 0 | 0 | 3 |

| cat | cat conc [µM] | PS | PS conc [mM] | e-D | e-D conc [M] | solvent A | additives | λexc [nm] | . | TON CO | TON H2 | TON HCOOH | . | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1. | 50 | 0.02 | 0.1 | 460 (LED) | 520 | 0 | 14 | |||||||
| 2. | 50 | 0.02 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 3 | 21 | ||||||
| 3. | 0 | 0.02 | 0.1 | 460 (LED) | 0 | 139 | 0 | |||||||
| 4. | 50 | 0.05 | 0.1 | 460 (LED) | 520 | 0 | 21 | |||||||
| 5. | 50 | 0.05 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 0 | 8 | ||||||
| 6. | 0 | 0.05 | 0.1 | 460 (LED) | 0 | 0 | 10 | |||||||
| 7. | 50 | 0.2 | 0.1 | 460 (LED) | 350 | 1 | 23 | |||||||
| 8. | 50 | 0.2 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 54 | 20 | ||||||
| 9. | 50 | 0 | 0.1 | 460 (LED) | 0 | 0 | 24 | |||||||
| 10. | 50 | 0.02 | 0.1 | 460 (LED) | 0 | 0 | 8 | |||||||
| 11. | 5 | 0.02 | 0.1 | 460 (LED) | 1365 | 0 | 115 | |||||||
| 12. | 5 | 0.02 | 0.1 | Argon atmosphere | 460 (LED) | 0 | 52 | 88 |

Sacrificial electron donor[edit | edit source]
In this study, the experiments were done with the sacrificial reductant BIH (100508).
Additives[edit | edit source]
In this study, control experiments were conducted under an argon atmosphere.
photochemistry, photocatalysis, CO2 reduction, homogeneous catalysis, cobalt catalyst, iron catalyst, quaterpyridine complexes, Ru(bpy)3, ruthenium photosensitizer, purpurin, organic dye sensitizer, BIH, sacrificial electron donor, visible-light irradiation, CO evolution, turnover number, selectivity, acetonitrile, triethanolamine, DMF, earth-abundant metals
Investigations
- Optimizations of conditions for Co(qpy)(H2O)2(ClO4)2 and Ru(bpy)3Cl2 (Molecular process, Photocatalytic CO2 conversion experiments)
- Optimizations of conditions for Fe(qpy)(H2O)2(ClO4)2 and Ru(bpy)3Cl2 (Molecular process, Photocatalytic CO2 conversion experiments)
- Optimizations of conditions for Co(qpy)(H2O)2(ClO4)2 and purpurin (Molecular process, Photocatalytic CO2 conversion experiments)
- Optimizations of conditions for Fe(qpy)(H2O)2(ClO4)2 (Molecular process, Photocatalytic CO2 conversion experiments)

